CAS 13276-53-4
:1-(2'-deoxy-beta-threopentofuranosyl)adenine
Description:
1-(2'-Deoxy-beta-threopentofuranosyl)adenine, with the CAS number 13276-53-4, is a nucleoside analog characterized by its structural similarity to adenosine, where the ribose sugar is replaced by a 2'-deoxy-beta-threopentofuranosyl moiety. This modification affects its biological properties and interactions, particularly in nucleic acid synthesis and metabolism. The compound features a purine base (adenine) linked to a sugar, which is essential for its role in biological systems. It is typically studied for its potential applications in molecular biology and medicinal chemistry, particularly in the context of antiviral and anticancer research. The presence of the deoxyribose sugar suggests that it may participate in DNA-related processes, while the specific stereochemistry of the sugar can influence its binding affinity and specificity for various enzymes and receptors. Overall, this compound represents a significant area of interest for researchers exploring nucleoside analogs and their therapeutic potentials.
Formula:C10H13N5O3
InChI:InChI=1/C10H13N5O3/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(17)6(2-16)18-7/h3-7,16-17H,1-2H2,(H2,11,12,13)/t5-,6-,7-/m1/s1
SMILES:C1[C@H]([C@@H](CO)O[C@H]1n1cnc2c(N)ncnc12)O
Synonyms:- 1-(2'-Deoxy-beta-D-threopentofuranosyl)adenine
- 1-Dpfa
- 9H-Purin-6-amine, 9-(2-deoxy-beta-D-threo-pentofuranosyl)-
- 9-(2-deoxypentofuranosyl)-9H-purin-6-amine
- 9-(2-deoxy-beta-D-threo-pentofuranosyl)-9H-purin-6-amine
- 1-(2'-Deoxy-beta-threopentofuranosyl)adenine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
9-(2-Deoxy-β-D-threo-pentofuranosyl)adenine
CAS:9-(2-Deoxy-beta-D-threo-pentofuranosyl)adenine is a Nucleoside Derivative - Xylo-nucleoside.Formula:C10H13N5O3Color and Shape:SolidMolecular weight:251.24Ref: TM-TNU1257
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire9-(2'-Deoxy-b-D-xylofuranosyl)adenine
CAS:9-(2'-Deoxy-b-D-xylofuranosyl)adenine is a nucleoside that is used in the treatment of bowel disease, cancer, and other diseases. It is also a potential drug target for antimicrobial agents and pharmacological agents. 9-(2'-Deoxy-b-D-xylofuranosyl)adenine has been shown to inhibit DNA synthesis and cause cell death in mouse tumor cells. It also inhibits adenosine uptake by binding to the A3 receptor, which may be due to its similarity to adenosine. This drug has been shown to have anticancer properties in various carcinoma cell lines. 9-(2'-Deoxy-b-D-xylofuranosyl)adenine is metabolized into deoxyadenosine, which can be converted back into adenosinergic acid or deoxyadenosinergic acid, which are potent inhibitors of DNA polymerase alpha activity.Purity:Min. 95%

