CymitQuimica logo

CAS 132766-40-6

:

pentafluorobenzyl-4-aminobenzoate

Description:
Pentafluorobenzyl-4-aminobenzoate is a chemical compound characterized by its unique structure, which includes a pentafluorobenzyl group and an aminobenzoate moiety. The presence of five fluorine atoms on the benzyl ring significantly enhances its electron-withdrawing properties, making it a highly reactive compound. This fluorinated structure contributes to its potential applications in various fields, including pharmaceuticals and materials science. The compound is typically a solid at room temperature and may exhibit low solubility in non-polar solvents due to its polar functional groups. Its reactivity can be attributed to the presence of the amino group, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound's fluorinated nature may impart unique physical properties, such as increased thermal stability and altered lipophilicity. Safety precautions should be observed when handling this compound, as fluorinated compounds can pose environmental and health risks. Overall, pentafluorobenzyl-4-aminobenzoate represents a versatile chemical entity with potential utility in advanced chemical synthesis and research applications.
Formula:C14H7F5NO2
InChI:InChI=1/C14H8F5NO2/c15-10-8(6-7-4-2-1-3-5-7)9(14(21)22)11(16)12(17)13(10)20(18)19/h1-5H,6H2,(H,21,22)/p-1
SMILES:c1ccc(cc1)Cc1c(c(c(c(c1F)N(F)F)F)F)C(=O)[O-]
Synonyms:
  • Pfbab
  • 2-Benzyl-4-(Difluoroamino)-3,5,6-Trifluorobenzoate
  • Pentafluorobenzyl-4-aminobenzoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.