CAS 13278-38-1
:N-(4-BROMOPHENYL)ANTHRANILIC ACID
Description:
N-(4-Bromophenyl)anthranilic acid, with the CAS number 13278-38-1, is an organic compound characterized by the presence of both an anthranilic acid moiety and a bromophenyl group. This compound typically exhibits a crystalline solid form and is soluble in organic solvents, while its solubility in water may vary depending on pH. The presence of the bromine atom introduces notable electronic effects, influencing the compound's reactivity and potential applications in medicinal chemistry and material science. The carboxylic acid functional group contributes to its acidity and potential for forming hydrogen bonds, which can affect its interactions in biological systems. Additionally, the compound may exhibit interesting photophysical properties due to the conjugated system formed by the anthranilic acid structure. Its derivatives and related compounds are often studied for their biological activities, including anti-inflammatory and antimicrobial properties. As with many brominated compounds, considerations regarding environmental impact and toxicity are essential in its handling and application.
Formula:C13H10BrNO2
InChI:InChI=1/C13H10BrNO2/c14-9-5-7-10(8-6-9)15-12-4-2-1-3-11(12)13(16)17/h1-8,15H,(H,16,17)
SMILES:c1ccc(c(c1)C(=O)O)Nc1ccc(cc1)Br
Synonyms:- 2-[(4-Bromophenyl)Amino]Benzoic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
