CAS 13278-47-2
:N-(2,3-DIMETHYLPHENYL)HYDRAZINECARBOTHIOAMIDE
Description:
N-(2,3-Dimethylphenyl)hydrazinecarbothioamide, with the CAS number 13278-47-2, is an organic compound characterized by the presence of a hydrazine functional group and a thioamide moiety. This compound features a dimethyl-substituted phenyl group, which contributes to its unique chemical properties and potential reactivity. Typically, thioamides exhibit characteristics similar to amides but with enhanced nucleophilicity due to the sulfur atom, which can influence the compound's behavior in various chemical reactions. The presence of the hydrazine group suggests potential applications in organic synthesis, particularly in the formation of hydrazones or as intermediates in the synthesis of more complex molecules. Additionally, compounds with hydrazine and thioamide functionalities may exhibit biological activity, making them of interest in medicinal chemistry. However, specific safety and handling precautions should be observed, as hydrazine derivatives can be toxic and potentially hazardous. Overall, N-(2,3-dimethylphenyl)hydrazinecarbothioamide represents a versatile compound with applications in both synthetic and medicinal chemistry.
Formula:C9H13N3S
InChI:InChI=1/C9H13N3S/c1-6-4-3-5-8(7(6)2)11-9(13)12-10/h3-5H,10H2,1-2H3,(H2,11,12,13)
SMILES:Cc1cccc(c1C)N=C(NN)S
Synonyms:- hydrazinecarbothioamide, N-(2,3-dimethylphenyl)-
- N-(2,3-Dimethylphenyl)hydrazinecarbothioamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
