CAS 13278-55-2
:N-(2,4-Dimethylphenyl)-N′-methylthiourea
Description:
N-(2,4-Dimethylphenyl)-N′-methylthiourea, with the CAS number 13278-55-2, is an organic compound characterized by its thiourea functional group, which consists of a carbon atom double-bonded to sulfur and single-bonded to nitrogen atoms. This compound features a dimethyl-substituted phenyl group, contributing to its hydrophobic characteristics and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the thiourea moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to form hydrogen bonds and interact with biological targets. Additionally, compounds of this class may exhibit antifungal or herbicidal properties. Safety data should be consulted for handling, as thioureas can pose health risks, including toxicity and potential carcinogenicity. Overall, N-(2,4-Dimethylphenyl)-N′-methylthiourea is a compound of interest in both synthetic and applied chemistry contexts.
Formula:C10H14N2S
InChI:InChI=1S/C10H14N2S/c1-7-4-5-9(8(2)6-7)12-10(13)11-3/h4-6H,1-3H3,(H2,11,12,13)
InChI key:InChIKey=HZAOAIZJMMTSFN-UHFFFAOYSA-N
SMILES:N(C(NC)=S)C1=C(C)C=C(C)C=C1
Synonyms:- 1-(2,4-Dimethyl-phenyl)-3-methyl-thiourea
- 1-(2,4-Dimethylphenyl)-3-Methylthiourea
- 1-(2,4-Dimethylphenyl)-3-methyl-2-thiourea
- 236-277-1
- N-(2,4-Dimethylphenyl)-N′-methylthiourea
- N-Methyl-N′-(2,4-dimethylphenyl)thiourea
- Thiourea, N-(2,4-dimethylphenyl)-N′-methyl-
- Urea, 1-methyl-2-thio-3-(2,4-xylyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
