CAS 13278-67-6
:4-Methylphenylthiosemicarbazide [4-(p-Tolyl)-3-thiosemicarbazide]
Description:
4-Methylphenylthiosemicarbazide, also known as 4-(p-Tolyl)-3-thiosemicarbazide, is an organic compound characterized by the presence of a thiosemicarbazide functional group attached to a para-methylphenyl moiety. This compound typically appears as a solid and is known for its potential biological activities, including antimicrobial and anticancer properties. The thiosemicarbazide structure features a sulfur atom bonded to a carbonyl group, which contributes to its reactivity and ability to form coordination complexes with metal ions. Its molecular structure allows for various interactions, making it a subject of interest in medicinal chemistry and material science. Additionally, 4-Methylphenylthiosemicarbazide may exhibit solubility in organic solvents, while its stability can be influenced by environmental conditions such as pH and temperature. As with many thiosemicarbazides, it is essential to handle this compound with care due to potential toxicity and reactivity, particularly in biological systems. Overall, its unique properties make it a valuable compound for research and application in various fields.
Formula:C8H11N3S
InChI:InChI=1/C8H11N3S/c1-6-2-4-7(5-3-6)11(10)8(9)12/h2-5H,10H2,1H3,(H2,9,12)
SMILES:Cc1ccc(cc1)N(C(=N)S)N
Synonyms:- 4-(4-Methylphenyl)-3-thiosemicarbazide
- 4-(p-Tolyl)-3-thiosemicarbazide
- N-(4-methylphenyl)hydrazinecarbothioamide
- 1-(4-Methylphenyl)Hydrazinecarbothioamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Hydrazinecarbothioamide, N-(4-methylphenyl)-
CAS:Formula:C8H11N3SPurity:95%Color and Shape:SolidMolecular weight:181.2580N-(p-Tolyl)hydrazinecarbothioamide
CAS:Formula:C8H11N3SPurity:>90.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:181.264-(4-Methylphenyl)-3-thiosemicarbazide
CAS:4-(4-Methylphenyl)-3-thiosemicarbazide is a carbonyl compound. It has been shown to be an inhibitor of acetylcholinesterase, an enzyme that breaks down the neurotransmitter acetylcholine, which is involved in muscle contraction. This inhibition causes paralysis and death in insects. 4-(4-Methylphenyl)-3-thiosemicarbazide has also been shown to be active against gram-negative bacteria. The structure of this molecule was determined by its vibrational spectra and multinuclear NMR data. 4-(4-Methylphenyl)-3-thiosemicarbazide stabilizes the dihedral angle between two nitrogen atoms, which are necessary for formation rate.
Formula:C8H11N3SPurity:Min. 95%Molecular weight:181.26 g/mol


