
CAS 132785-32-1
:(2S,3S,4S)-2-Carboxy-4-(2-hydroxyphenyl)-3-pyrrolidineacetic acid
Description:
(2S,3S,4S)-2-Carboxy-4-(2-hydroxyphenyl)-3-pyrrolidineacetic acid, with CAS number 132785-32-1, is a chiral compound characterized by its pyrrolidine ring structure, which contributes to its stereochemistry. This substance features a carboxylic acid functional group, which imparts acidic properties, and a hydroxyl group attached to a phenyl ring, enhancing its potential for hydrogen bonding and solubility in polar solvents. The presence of multiple chiral centers indicates that it can exist in different stereoisomeric forms, which may influence its biological activity and interactions. This compound may be of interest in pharmaceutical research due to its structural complexity and potential applications in drug design, particularly in the development of compounds that target specific biological pathways. Its unique configuration may also affect its pharmacokinetics and pharmacodynamics, making it a subject of study in medicinal chemistry. Overall, the compound's characteristics suggest it could play a role in various chemical and biological processes.
Formula:C13H15NO5
InChI:InChI=1S/C13H15NO5/c15-10-4-2-1-3-7(10)9-6-14-12(13(18)19)8(9)5-11(16)17/h1-4,8-9,12,14-15H,5-6H2,(H,16,17)(H,18,19)/t8-,9+,12-/m0/s1
InChI key:InChIKey=JSMYHXFFKXKZRN-SBMIAAHKSA-N
SMILES:C(C(O)=O)[C@H]1[C@H](CN[C@@H]1C(O)=O)C2=C(O)C=CC=C2
Synonyms:- (2S,3S,4S)-2-Carboxy-4-(2-hydroxyphenyl)-3-pyrrolidineacetic acid
- 3-Pyrrolidineacetic acid, 2-carboxy-4-(2-hydroxyphenyl)-, [2S-(2α,3β,4β)]-
- 3-Pyrrolidineacetic acid, 2-carboxy-4-(2-hydroxyphenyl)-, (2S,3S,4S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Pyrrolidineacetic acid, 2-carboxy-4-(2-hydroxyphenyl)-, (2S,3S,4S)-
CAS:Formula:C13H15NO5Molecular weight:265.2619
