
CAS 13279-06-6
:N-[4-(Dimethylamino)phenyl]octadecanamide
Description:
N-[4-(Dimethylamino)phenyl]octadecanamide, also known by its CAS number 13279-06-6, is an organic compound characterized by its long hydrophobic alkyl chain and a polar amide functional group. This substance features a dimethylamino group attached to a phenyl ring, which contributes to its amphiphilic nature, allowing it to interact with both hydrophobic and hydrophilic environments. The octadecanamide portion of the molecule provides significant hydrophobic character, making it soluble in organic solvents while exhibiting limited solubility in water. This compound is often studied for its potential applications in surfactants, emulsifiers, and as a component in various formulations in the fields of pharmaceuticals and materials science. Its unique structure may also impart specific biological activities, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and environmental impact.
Formula:C26H46N2O
InChI:InChI=1S/C26H46N2O/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-26(29)27-24-20-22-25(23-21-24)28(2)3/h20-23H,4-19H2,1-3H3,(H,27,29)
InChI key:InChIKey=OOJMUMUFHMMPJC-UHFFFAOYSA-N
SMILES:N(C(CCCCCCCCCCCCCCCCC)=O)C1=CC=C(N(C)C)C=C1
Synonyms:- N-[4-(Dimethylamino)phenyl]octadecanamide
- Octadecanamide, N-[4-(dimethylamino)phenyl]-
- Octadecananilide, 4′-(dimethylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
