CymitQuimica logo

CAS 13279-58-8

:

4-(Acetylamino)-2,5-dimethoxybenzenesulfonyl chloride

Description:
4-(Acetylamino)-2,5-dimethoxybenzenesulfonyl chloride, with the CAS number 13279-58-8, is a chemical compound characterized by its sulfonyl chloride functional group, which makes it a reactive electrophile. This compound features an acetylamino group and two methoxy substituents on a benzene ring, contributing to its unique reactivity and potential applications in organic synthesis. The presence of the sulfonyl chloride group indicates that it can participate in nucleophilic substitution reactions, making it useful for introducing sulfonamide functionalities into other molecules. The methoxy groups enhance the compound's solubility in organic solvents and may influence its electronic properties, affecting reactivity. Additionally, the acetylamino group can provide sites for further chemical modifications. Overall, this compound is of interest in medicinal chemistry and materials science, where it may serve as an intermediate in the synthesis of pharmaceuticals or other complex organic molecules. Proper handling and storage are essential due to its reactive nature, particularly in the presence of moisture, which can lead to hydrolysis.
Formula:C10H12ClNO5S
InChI:InChI=1S/C10H12ClNO5S/c1-6(13)12-7-4-9(17-3)10(18(11,14)15)5-8(7)16-2/h4-5H,1-3H3,(H,12,13)
InChI key:InChIKey=QMJIZLZFBGRSAS-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=C(OC)C=C(NC(C)=O)C(OC)=C1
Synonyms:
  • 4-(Acetylamino)-2,5-Dimethoxybenzenesulfonyl Chloride
  • 4-Acetamido-2,5-dimethoxybenzenesulfonyl chloride
  • 4-Chlorosulfonyl-2,5-dimethoxyacetanilide
  • Benzenesulfonyl chloride, 4-(acetylamino)-2,5-dimethoxy-
  • Sulfanilyl chloride, N-acetyl-2,5-dimethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.