CAS 132794-09-3
:4-Chloro-2,5-difluorobenzoyl fluoride
Description:
4-Chloro-2,5-difluorobenzoyl fluoride is an organic compound characterized by its aromatic structure, which includes a benzoyl group substituted with chlorine and fluorine atoms. The presence of the chloro and difluoro substituents on the benzene ring significantly influences its chemical reactivity and physical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its role as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. The fluorine atoms enhance its lipophilicity and stability, making it useful in applications requiring high reactivity and selectivity. Additionally, the compound may exhibit moderate toxicity, necessitating careful handling and appropriate safety measures during its use in laboratory or industrial settings. Its reactivity can be attributed to the presence of the acyl fluoride functional group, which is known to participate in nucleophilic acyl substitution reactions. Overall, 4-Chloro-2,5-difluorobenzoyl fluoride is a valuable compound in synthetic organic chemistry.
Formula:C7H2ClF3O
InChI:InChI=1S/C7H2ClF3O/c8-4-2-5(9)3(7(11)12)1-6(4)10/h1-2H
InChI key:InChIKey=FECDFWHSCBRZQR-UHFFFAOYSA-N
SMILES:C(F)(=O)C1=C(F)C=C(Cl)C(F)=C1
Synonyms:- Benzoyl fluoride, 4-chloro-2,5-difluoro-
- 4-Chloro-2,5-difluorobenzoyl fluoride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
