CymitQuimica logo

CAS 132796-57-7

:

(2S,4aS,5R,6R,8aR)-Decahydro-5-[(3R)-3-hydroxy-3-methyl-4-penten-1-yl]-1,1,4a,6-tetramethyl-2,6-naphthalenediol

Description:
The chemical substance with the name "(2S,4aS,5R,6R,8aR)-Decahydro-5-[(3R)-3-hydroxy-3-methyl-4-penten-1-yl]-1,1,4a,6-tetramethyl-2,6-naphthalenediol" and CAS number "132796-57-7" is a complex organic compound characterized by its multi-ring structure and multiple stereocenters, which contribute to its specific three-dimensional configuration. This compound features a naphthalene core, which is a bicyclic aromatic hydrocarbon, modified with various functional groups, including hydroxyl groups and a branched alkyl chain. The presence of multiple chiral centers indicates that it can exist in different stereoisomeric forms, potentially influencing its biological activity and interactions. The hydroxyl groups suggest that the compound may exhibit polar characteristics, which could affect its solubility in various solvents. Additionally, the presence of a pentenyl side chain may impart reactivity and potential for further chemical transformations. Overall, this compound's structural complexity and functional groups suggest it may have applications in fields such as pharmaceuticals or organic synthesis, although specific properties like melting point, boiling point, and reactivity would require empirical data for precise characterization.
Formula:C20H36O3
InChI:InChI=1S/C20H36O3/c1-7-18(4,22)11-8-15-19(5)12-10-16(21)17(2,3)14(19)9-13-20(15,6)23/h7,14-16,21-23H,1,8-13H2,2-6H3/t14-,15+,16-,18-,19-,20+/m0/s1
InChI key:InChIKey=GHXNUBMJNAHZRP-CJEFFJQMSA-N
SMILES:C[C@@]12[C@](C(C)(C)[C@@H](O)CC1)(CC[C@@](C)(O)[C@@H]2CC[C@@](C=C)(C)O)[H]
Synonyms:
  • 2,6-Naphthalenediol, decahydro-5-[(3R)-3-hydroxy-3-methyl-4-penten-1-yl]-1,1,4a,6-tetramethyl-, (2S,4aS,5R,6R,8aR)-
  • 2,6-Naphthalenediol, decahydro-5-(3-hydroxy-3-methyl-4-pentenyl)-1,1,4a,6-tetramethyl-, [2S-[2α,4aα,5α(S*),6β,8aβ]]-
  • 2,6-Naphthalenediol, decahydro-5-[(3R)-3-hydroxy-3-methyl-4-pentenyl]-1,1,4a,6-tetramethyl-, (2S,4aS,5R,6R,8aR)-
  • (2S,4aS,5R,6R,8aR)-Decahydro-5-[(3R)-3-hydroxy-3-methyl-4-penten-1-yl]-1,1,4a,6-tetramethyl-2,6-naphthalenediol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.