
CAS 13280-00-7
:3-Chloro-2-pentanone
Description:
3-Chloro-2-pentanone is an organic compound classified as a ketone, characterized by the presence of a carbonyl group (C=O) adjacent to a chlorine atom and a pentane chain. Its molecular formula is C5H9ClO, indicating it contains five carbon atoms, nine hydrogen atoms, one chlorine atom, and one oxygen atom. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents and exhibits moderate polarity due to the presence of the carbonyl group. 3-Chloro-2-pentanone is used in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals and agrochemicals. As with many chlorinated compounds, it may pose environmental and health risks, necessitating careful handling and disposal. Its reactivity can be influenced by the presence of the chlorine atom, making it a useful building block in organic synthesis. Safety data sheets should be consulted for specific handling and exposure guidelines.
Formula:C5H9ClO
InChI:InChI=1S/C5H9ClO/c1-3-5(6)4(2)7/h5H,3H2,1-2H3
InChI key:InChIKey=CKSIBFLEDRJUTN-UHFFFAOYSA-N
SMILES:C(C(C)=O)(CC)Cl
Synonyms:- 2-Pentanone, 3-chloro-
- 3-Chloro-2-pentanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
