CAS 13280-60-9: 5-Amino-2-nitrobenzoic Acid
Description:5-Amino-2-nitrobenzoic acid is an organic compound characterized by the presence of both amino and nitro functional groups attached to a benzoic acid structure. Its molecular formula is C7H6N2O3, indicating it contains seven carbon atoms, six hydrogen atoms, two nitrogen atoms, and three oxygen atoms. This compound typically appears as a yellow crystalline solid and is soluble in polar solvents such as water and alcohol, owing to its carboxylic acid and amino groups. The nitro group contributes to its reactivity, making it useful in various chemical syntheses and applications, including as an intermediate in dye production and pharmaceuticals. The presence of the amino group allows for further derivatization, enhancing its utility in organic synthesis. Additionally, 5-amino-2-nitrobenzoic acid can exhibit biological activity, which may be of interest in medicinal chemistry. Safety data should be consulted, as with many nitro compounds, it may pose hazards such as toxicity or environmental concerns.
Formula:C7H5N2O4
InChI:InChI=1S/C7H6N2O4/c8-4-1-2-6(9(12)13)5(3-4)7(10)11/h1-3H,8H2,(H,10,11)
InChI key:InChIKey=KZZWQCKYLNIOBT-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC(N)=CC=C1N(=O)=O
- Synonyms:
- 2-Nitro-5-Aminobenzoic Acid
- 3-Carboxy-4-Nitroaniline
- 5-Amino-2-Nitrobenzoate
- Anba
- Benzoic acid, 5-amino-2-nitro-
- NSC 74455
- Timtec-Bb Sbb008583
![5-Amino-2-nitrobenzoic Acid (Purified) [for γ-GT]](https://static.cymitquimica.com/products/3B/thumb/A1048.jpg)
