
CAS 13281-06-6
:N1-(2-Ethylhexyl)-1,3-propanediamine
Description:
N1-(2-Ethylhexyl)-1,3-propanediamine, with the CAS number 13281-06-6, is an organic compound characterized by its aliphatic amine structure. It features a propanediamine backbone with a 2-ethylhexyl substituent, which contributes to its hydrophobic properties. This compound is typically a colorless to pale yellow liquid and is soluble in organic solvents, while exhibiting limited solubility in water due to its long hydrocarbon chain. N1-(2-Ethylhexyl)-1,3-propanediamine is known for its applications in various industrial processes, including as a surfactant, corrosion inhibitor, and in the formulation of certain polymers. Its amine functional groups can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, it may exhibit biological activity, which necessitates careful handling and consideration of safety protocols during its use. Overall, this compound's unique structure and properties make it valuable in both chemical manufacturing and research applications.
Formula:C11H26N2
InChI:InChI=1S/C11H26N2/c1-3-5-7-11(4-2)10-13-9-6-8-12/h11,13H,3-10,12H2,1-2H3
InChI key:InChIKey=XKXKBRKXBRLPNS-UHFFFAOYSA-N
SMILES:C(CNCCCN)(CCCC)CC
Synonyms:- 1,3-Propanediamine, N-(2-ethylhexyl)-
- N1-(2-Ethylhexyl)-1,3-propanediamine
- N-(2-Ethylhexyl)-1,3-propylenediamine
- N-(2-Ethylhexyl)trimethylenediamine
- 1,3-Propanediamine, N1-(2-ethylhexyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.