CymitQuimica logo

CAS 132828-63-8

:

phenylthiohydantoin-3,4-dihydroxyphenylalanine

Description:
Phenylthiohydantoin-3,4-dihydroxyphenylalanine, identified by its CAS number 132828-63-8, is a chemical compound that features a unique structure combining elements of hydantoin and amino acids. This compound is characterized by the presence of a phenylthio group, which contributes to its reactivity and potential applications in biochemical contexts. The incorporation of 3,4-dihydroxyphenylalanine, an amino acid derivative, suggests that it may exhibit properties relevant to neurotransmitter synthesis or other biological processes. The hydroxyl groups in the structure can enhance solubility and reactivity, making it a candidate for various chemical reactions, including those involving enzymatic activity. Additionally, the compound may be of interest in pharmaceutical research due to its potential interactions with biological systems. Its specific characteristics, such as melting point, solubility, and stability, would depend on the conditions under which it is studied, but overall, it represents a complex molecule with potential utility in both synthetic and biological chemistry.
Formula:C16H14N2O3S
InChI:InChI=1/C16H14N2O3S/c19-13-7-6-10(9-14(13)20)8-12-15(21)18(16(22)17-12)11-4-2-1-3-5-11/h1-7,9,12,19-20H,8H2,(H,17,22)/t12-/m0/s1
Synonyms:
  • 4-Imidazolidinone, 5-((3,4-dihydroxyphenyl)methyl)-3-phenyl-2-thioxo-, (S)-
  • (S)-5-((3,4-Dihydroxyphenyl)methyl)-3-phenyl-2-thioxo-4-imidazolidinone
  • (5S)-5-(3,4-dihydroxybenzyl)-3-phenyl-2-thioxoimidazolidin-4-one
  • Phenylthiohydantoin-3,4-dihydroxyphenylalanine
  • Pth-dopa
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.