
CAS 13283-44-8
:2-Propenoic acid, 2-methyl-, 1,1′-[2,2-dimethyl-1-(1-methylethyl)-1,3-propanediyl] ester
Description:
The chemical substance known as "2-Propenoic acid, 2-methyl-, 1,1′-[2,2-dimethyl-1-(1-methylethyl)-1,3-propanediyl] ester," with CAS number 13283-44-8, is an ester derived from acrylic acid and a specific branched alkyl group. This compound typically exhibits characteristics common to esters, such as being a colorless to pale yellow liquid with a fruity odor. It is likely to be soluble in organic solvents while having limited solubility in water due to its hydrophobic alkyl chains. The presence of the propenoic acid moiety suggests that it can participate in polymerization reactions, making it useful in the production of polymers and copolymers. Additionally, the branched structure may impart unique properties such as enhanced thermal stability and lower viscosity compared to linear analogs. This compound may find applications in coatings, adhesives, and other materials where flexibility and durability are desired. Safety data should be consulted for handling and exposure guidelines, as with all chemical substances.
Formula:C16H26O4
InChI:InChI=1S/C16H26O4/c1-10(2)13(20-15(18)12(5)6)16(7,8)9-19-14(17)11(3)4/h10,13H,3,5,9H2,1-2,4,6-8H3
InChI key:InChIKey=TVGGFVNRRGKACD-UHFFFAOYSA-N
SMILES:C(C(COC(C(C)=C)=O)(C)C)(OC(C(C)=C)=O)C(C)C
Synonyms:- 2,2,4-Trimethyl-1,3-pentanediol dimethacrylate
- 2-Propenoic acid, 2-methyl-, 2,2-dimethyl-1-(1-methylethyl)-1,3-propanediyl ester
- 2-Propenoic acid, 2-methyl-, 1,1′-[2,2-dimethyl-1-(1-methylethyl)-1,3-propanediyl] ester
- Methacrylic acid, 1-isopropyl-2,2-dimethyltrimethylene ester
- 1,3-Pentanediol, 2,2,4-trimethyl-, dimethacrylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Propenoic acid, 2-methyl-, 1,1'-[2,2-dimethyl-1-(1-methylethyl)-1,3-propanediyl] ester
CAS:Formula:C16H30O6Molecular weight:318.4058
