CAS 13283-68-6
:Octadecanoic acid, bismuth(3+) salt (3:1)
Description:
Octadecanoic acid, bismuth(3+) salt (3:1), also known as bismuth stearate, is a chemical compound formed from the reaction of bismuth ions with stearic acid. This substance typically appears as a white to pale yellow powder and is insoluble in water but soluble in organic solvents. It is characterized by its ability to act as a lubricant and a stabilizer in various applications, particularly in the pharmaceutical and cosmetic industries. Bismuth stearate is often utilized as a thickening agent in ointments and creams, providing a smooth texture and enhancing the product's stability. Additionally, it exhibits antimicrobial properties, making it beneficial in formulations aimed at skin protection. The compound's unique properties stem from the coordination of bismuth ions with the long-chain fatty acid, which influences its behavior in different environments. Safety data indicates that while it is generally considered safe for topical use, appropriate handling and usage guidelines should be followed to minimize any potential risks.
Formula:C18H36O2Bi
InChI:InChI=1S/C18H36O2.Bi/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2-17H2,1H3,(H,19,20);
InChI key:InChIKey=GTZVAQNNZUMIAR-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCC)CCCCCC(O)=O.[Bi]
Synonyms:- Octadecanoic acid, bismuth(3+) salt
- Octadecanoic acid, bismuth(3+) salt (3:1)
- Bismuth tristearate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
