CAS 132838-26-7

1-[3-(2-Fluoroethoxy)phenyl]ethanone

Description:

1-[3-(2-Fluoroethoxy)phenyl]ethanone, with the CAS number 132838-26-7, is an organic compound characterized by its ketone functional group and a substituted phenyl ring. The presence of the 2-fluoroethoxy group indicates that it has a fluorinated ethoxy substituent, which can influence its chemical reactivity and physical properties. This compound typically exhibits moderate polarity due to the presence of both the ketone and ether functionalities. It may be soluble in organic solvents like ethanol and dichloromethane, while its solubility in water is likely limited. The fluorine atom can enhance the compound's lipophilicity and may also affect its biological activity, making it of interest in medicinal chemistry. Additionally, the compound's structure suggests potential applications in pharmaceuticals or agrochemicals, where modifications to the phenyl ring can lead to variations in activity. Safety data and handling precautions should be reviewed, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₀H₁₁FO₂

InChI: InChI=1S/C10H11FO2/c1-8(12)9-3-2-4-10(7-9)13-6-5-11/h2-4,7H,5-6H2,1H3

InChI key: InChIKey=XDPNCIBAQSMANJ-UHFFFAOYSA-N

SMILES: O(CCF)C1=CC(C(C)=O)=CC=C1

Synonyms:

• Ethanone, 1-[3-(2-fluoroethoxy)phenyl]-
• 1-[3-(2-Fluoroethoxy)phenyl]ethanone
• 1-[3-(2-Fluoroethoxy)phenyl]ethan-1-one