CAS 13284-97-4

1,1′-Sulfinylbis[cyclohexane]

Description:

1,1′-Sulfinylbis[cyclohexane], with the CAS number 13284-97-4, is an organic compound characterized by the presence of a sulfinyl functional group (-S=O) bonded to two cyclohexane rings. This compound typically exhibits a relatively high molecular weight due to the bulky cyclohexane structures. The sulfinyl group introduces polarity to the molecule, which can influence its solubility and reactivity compared to non-polar hydrocarbons. The cyclohexane rings contribute to the compound's hydrophobic characteristics, making it less soluble in polar solvents. Additionally, the presence of the sulfinyl group can enhance the compound's reactivity, allowing it to participate in various chemical reactions, such as oxidation or nucleophilic substitution. The compound's structural features may also lead to interesting conformational behavior, as cyclohexane rings can adopt different chair and boat conformations. Overall, 1,1′-Sulfinylbis[cyclohexane] is a unique compound with potential applications in organic synthesis and materials science, although specific applications may depend on further research and development.

Formula: C₁₂H₂₂OS

InChI: InChI=1S/C12H22OS/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h11-12H,1-10H2

InChI key: InChIKey=XWJJFJIOTQSSAR-UHFFFAOYSA-N

SMILES: S(=O)(C1CCCCC1)C2CCCCC2

Synonyms:

• Cyclohexyl sulfoxide
• Dicyclohexyl sulfoxide
• (Cyclohexanesulfinyl)cyclohexane
• 1,1′-Sulfinylbis[cyclohexane]
• Cyclohexane, 1,1′-sulfinylbis-

Cyclohexane, 1,1'-sulfinylbis-

CAS: 13284-97-4

Formula: C₁₂H₂₂OS

Molecular weight: 214.3675

Ref: IN-DA00119H