CymitQuimica logo

CAS 132856-34-9

:

chloro-[(2,4,6-trimethylphenyl)methyl]magnesium

Description:
Chloro-[(2,4,6-trimethylphenyl)methyl]magnesium, with the CAS number 132856-34-9, is an organomagnesium compound that belongs to the class of Grignard reagents. This compound features a magnesium atom bonded to a chloro group and a bulky aryl group derived from 2,4,6-trimethylphenyl. The presence of the trimethylphenyl moiety imparts significant steric hindrance, which can influence its reactivity and interactions with other chemical species. Grignard reagents are known for their nucleophilic properties, making them valuable in organic synthesis, particularly for forming carbon-carbon bonds. The compound is typically handled under anhydrous conditions due to its reactivity with moisture, which can lead to the formation of unwanted byproducts. Its applications may include the synthesis of complex organic molecules, where it acts as a nucleophile in various reactions, such as alkylation and coupling reactions. Safety precautions are essential when working with this reagent, as it can react violently with water and air.
Formula:C10H13ClMg
InChI:InChI=1/C10H13.ClH.Mg/c1-7-5-8(2)10(4)9(3)6-7;;/h5-6H,4H2,1-3H3;1H;/q;;+1/p-1/rC10H13ClMg/c1-7-4-8(2)10(6-12-11)9(3)5-7/h4-5H,6H2,1-3H3
SMILES:CC1=CC(C)C(=C)C(=C1)C.Cl.[Mg]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.