CAS 13286-59-4
:(1S,2S)-1-AMINO-2,3-DIHYDRO-1H-INDEN-2-OL
Description:
(1S,2S)-1-Amino-2,3-dihydro-1H-inden-2-ol, with the CAS number 13286-59-4, is an organic compound characterized by its bicyclic structure, which includes an indene framework. This compound features an amino group (-NH2) and a hydroxyl group (-OH) attached to the second carbon of the indene ring, contributing to its reactivity and potential biological activity. The stereochemistry indicated by (1S,2S) suggests specific spatial arrangements of the substituents, which can influence its interactions in biological systems. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the hydroxyl group. Its properties make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as it may exhibit various biological activities. Additionally, the presence of both an amino and a hydroxyl group allows for potential hydrogen bonding, which can affect its solubility and reactivity in different environments.
Formula:C9H11NO
InChI:InChI=1/C9H11NO/c10-9-7-4-2-1-3-6(7)5-8(9)11/h1-4,8-9,11H,5,10H2/t8-,9-/m0/s1
SMILES:c1ccc2c(c1)C[C@@H]([C@H]2N)O
Synonyms:- (1S,2S)-1-Aminoindan-2-ol
- 1H-Inden-2-ol, 1-amino-2,3-dihydro-, (1S,2S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
