
CAS 13286-91-4
:2-(Methylthio)pentane
Description:
2-(Methylthio)pentane, with the CAS number 13286-91-4, is an organic compound characterized by the presence of a methylthio group (-S-CH3) attached to a pentane backbone. This compound is classified as a thioether, which is a type of sulfur-containing organic compound. Its molecular structure consists of a five-carbon chain (pentane) with a sulfur atom bonded to a methyl group at the second carbon position. This configuration influences its physical properties, such as boiling and melting points, which are typically lower than those of corresponding alcohols or ethers due to the presence of the sulfur atom. 2-(Methylthio)pentane is likely to be a colorless liquid at room temperature and may have a characteristic odor associated with sulfur compounds. It is soluble in organic solvents and may exhibit moderate reactivity, particularly in the presence of strong oxidizing agents. As with many thioethers, it may also participate in various chemical reactions, including nucleophilic substitutions and oxidation processes. Safety precautions should be taken when handling this compound due to potential toxicity and irritant properties.
Formula:C6H14S
InChI:InChI=1S/C6H14S/c1-4-5-6(2)7-3/h6H,4-5H2,1-3H3
InChI key:InChIKey=WGBHWWSSUGCSCP-UHFFFAOYSA-N
SMILES:C(CCC)(SC)C
Synonyms:- 2-(Methylthio)pentane
- 2-Pentyl methyl sulfide
- Sulfide, methyl 1-methylbutyl
- Pentane, 2-(methylthio)-
- 3-Methyl-2-thiahexane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
