
CAS 132864-55-2
:Tetrahydro-3-thiopheneacetic acid
Description:
Tetrahydro-3-thiopheneacetic acid is a chemical compound characterized by its unique structure, which includes a thiophene ring and an acetic acid functional group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of the thiophene ring contributes to its aromatic properties, while the acetic acid moiety provides acidity and reactivity. Tetrahydro-3-thiopheneacetic acid may exhibit moderate solubility in polar solvents, and its reactivity can be influenced by the functional groups present in its structure. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken. Overall, this compound represents an interesting area of study within the field of organic chemistry due to its structural features and potential applications.
Formula:C6H10O2S
InChI:InChI=1S/C6H10O2S/c7-6(8)3-5-1-2-9-4-5/h5H,1-4H2,(H,7,8)
InChI key:InChIKey=CQNGUSHCIYIMRK-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1CCSC1
Synonyms:- (Tetrahydrothiophen-3-yl)acetic acid
- 3-Thiopheneacetic acid, tetrahydro-
- Tetrahydro-3-thiopheneacetic acid
- 2-(Thiolan-3-yl)acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.