CAS 1328640-34-1

1-Methyl-3-(1-methylethyl)-1H-pyrazole-5-ethanamine

Description:

1-Methyl-3-(1-methylethyl)-1H-pyrazole-5-ethanamine, identified by its CAS number 1328640-34-1, is a chemical compound that belongs to the class of pyrazoles, which are five-membered heterocyclic compounds containing two nitrogen atoms. This substance features a methyl group and an isopropyl group attached to the pyrazole ring, along with an ethanamine side chain, contributing to its unique structural characteristics. The presence of these functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may exhibit various biological activities, which can be attributed to its structural features. Additionally, its solubility, stability, and reactivity can be influenced by the substituents on the pyrazole ring. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound may not be fully characterized. Further research is necessary to explore its potential applications and biological effects comprehensively.

Formula: C₉H₁₇N₃

InChI: InChI=1S/C9H17N3/c1-7(2)9-6-8(4-5-10)12(3)11-9/h6-7H,4-5,10H2,1-3H3

InChI key: InChIKey=XOGBOWKCPKGZFZ-UHFFFAOYSA-N

SMILES: C(CN)C1=CC(C(C)C)=NN1C

Synonyms:

• 1H-Pyrazole-5-ethanamine, 1-methyl-3-(1-methylethyl)-
• 1-Methyl-3-(1-methylethyl)-1H-pyrazole-5-ethanamine