CymitQuimica logo

CAS 1328640-35-2

:

5-(Chloromethyl)-1-cyclopentyl-1H-pyrazole

Description:
5-(Chloromethyl)-1-cyclopentyl-1H-pyrazole is a chemical compound characterized by its pyrazole ring, which is a five-membered aromatic heterocycle containing two adjacent nitrogen atoms. The presence of a chloromethyl group (-CH2Cl) at the 5-position of the pyrazole enhances its reactivity, making it a potential intermediate in organic synthesis. The cyclopentyl group attached to the 1-position contributes to the compound's hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in agrochemicals or pharmaceuticals, particularly in the development of new therapeutic agents. The compound's stability, reactivity, and potential for further functionalization are key characteristics that can be explored in research and industrial applications. As with many chemical substances, safety data and handling precautions should be considered due to the presence of the chloromethyl group, which can pose hazards.
Formula:C9H13ClN2
InChI:InChI=1S/C9H13ClN2/c10-7-9-5-6-11-12(9)8-3-1-2-4-8/h5-6,8H,1-4,7H2
InChI key:InChIKey=JMFZWOQTWNDMRI-UHFFFAOYSA-N
SMILES:C(Cl)C=1N(N=CC1)C2CCCC2
Synonyms:
  • 5-(Chloromethyl)-1-cyclopentyl-1H-pyrazole
  • 1H-Pyrazole, 5-(chloromethyl)-1-cyclopentyl-
Found 1 products.