CAS 1328640-53-4

1-Cyclopentyl-1H-pyrazole-5-acetonitrile

Description:

1-Cyclopentyl-1H-pyrazole-5-acetonitrile is a chemical compound characterized by its unique structure, which includes a cyclopentyl group and a pyrazole ring. The presence of the acetonitrile functional group contributes to its reactivity and potential applications in various chemical reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. The pyrazole moiety is often associated with diverse biological properties, including anti-inflammatory and analgesic effects. Additionally, the compound's stability and reactivity can be influenced by factors such as temperature and pH. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks if ingested or inhaled. Overall, 1-Cyclopentyl-1H-pyrazole-5-acetonitrile represents a valuable compound for further study in both synthetic and medicinal chemistry.

Formula: C₁₀H₁₃N₃

InChI: InChI=1S/C10H13N3/c11-7-5-10-6-8-12-13(10)9-3-1-2-4-9/h6,8-9H,1-5H2

InChI key: InChIKey=SYSYANCHWMVUSX-UHFFFAOYSA-N

SMILES: C(C#N)C=1N(N=CC1)C2CCCC2

Synonyms:

• 1H-Pyrazole-5-acetonitrile, 1-cyclopentyl-
• 1-Cyclopentyl-1H-pyrazole-5-acetonitrile