CAS 1328640-61-4
:1-Methyl-3-(trifluoromethyl)-1H-pyrazole-5-acetonitrile
Description:
1-Methyl-3-(trifluoromethyl)-1H-pyrazole-5-acetonitrile is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a methyl group and a trifluoromethyl group, as well as an acetonitrile functional group. This compound is notable for its potential applications in various fields, including agrochemicals and pharmaceuticals, due to the presence of the trifluoromethyl group, which often enhances biological activity and lipophilicity. The pyrazole moiety contributes to its reactivity and interaction with biological targets. In terms of physical properties, it is typically a solid at room temperature, with solubility in organic solvents. The presence of the acetonitrile group suggests potential for nucleophilic reactions, making it a versatile intermediate in synthetic chemistry. Safety data should be consulted for handling, as compounds with trifluoromethyl groups can exhibit unique toxicological profiles. Overall, 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-5-acetonitrile is a compound of interest for research and development in various chemical applications.
Formula:C7H6F3N3
InChI:InChI=1S/C7H6F3N3/c1-13-5(2-3-11)4-6(12-13)7(8,9)10/h4H,2H2,1H3
InChI key:InChIKey=ISEAHNXKEIXGTH-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(CC#N)N(C)N1
Synonyms:- 1H-Pyrazole-5-acetonitrile, 1-methyl-3-(trifluoromethyl)-
- 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-5-acetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.