CAS 1328640-63-6

3-Amino-1-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxylic acid

Description:

3-Amino-1-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxylic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an amino group and a carboxylic acid functional group, contributing to its potential as a versatile building block in organic synthesis and medicinal chemistry. The presence of the trifluoroethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The compound's molecular structure suggests it may exhibit specific interactions with biological targets, potentially leading to applications in drug development. Additionally, the presence of fluorine atoms often imparts unique properties, such as increased metabolic stability and altered pharmacokinetics. As with many pyrazole derivatives, this compound may also exhibit interesting reactivity patterns, making it a candidate for further investigation in various chemical reactions and applications. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₆H₆F₃N₃O₂

InChI: InChI=1S/C6H6F3N3O2/c7-6(8,9)2-12-3(5(13)14)1-4(10)11-12/h1H,2H2,(H2,10,11)(H,13,14)

InChI key: InChIKey=JEGNEKPMRJPCHV-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)N1C(C(O)=O)=CC(N)=N1

Synonyms:

• 1H-Pyrazole-5-carboxylic acid, 3-amino-1-(2,2,2-trifluoroethyl)-
• 3-Amino-1-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxylic acid