CAS 1328640-72-7

1-Ethyl-3-nitro-1H-pyrazole-5-methanol

Description:

1-Ethyl-3-nitro-1H-pyrazole-5-methanol is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of an ethyl group and a nitro group at specific positions on the pyrazole ring contributes to its unique chemical properties. The methanol functional group at the 5-position enhances its reactivity and solubility in polar solvents. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and agricultural applications. Its nitro group can participate in various chemical reactions, including reduction and nucleophilic substitution, while the pyrazole framework can engage in coordination with metal ions. The compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. As with many nitro-containing compounds, it is essential to handle it with care due to potential toxicity and environmental impact. Further studies are often required to fully understand its properties and potential applications in various fields.

Formula: C₆H₉N₃O₃

InChI: InChI=1S/C6H9N3O3/c1-2-8-5(4-10)3-6(7-8)9(11)12/h3,10H,2,4H2,1H3

InChI key: InChIKey=WRLXCBQBIBOACP-UHFFFAOYSA-N

SMILES: C(O)C=1N(CC)N=C(N(=O)=O)C1

Synonyms:

• 1-Ethyl-3-nitro-1H-pyrazole-5-methanol
• 1H-Pyrazole-5-methanol, 1-ethyl-3-nitro-