
CAS 1328640-73-8
:Methyl 3-amino-1-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxylate
Description:
Methyl 3-amino-1-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxylate is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a carboxylate group, which contributes to its acidic properties, and an amino group that can participate in hydrogen bonding, enhancing its reactivity and potential biological activity. The presence of the trifluoroethyl group introduces significant electronegativity, which can influence the compound's lipophilicity and overall stability. This structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can interact with biological targets. Additionally, the compound's unique fluorinated moiety may impart desirable properties such as increased metabolic stability or altered pharmacokinetics. Overall, Methyl 3-amino-1-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxylate is a compound of interest for further research in various chemical and biological contexts.
Formula:C7H8F3N3O2
InChI:InChI=1S/C7H8F3N3O2/c1-15-6(14)4-2-5(11)12-13(4)3-7(8,9)10/h2H,3H2,1H3,(H2,11,12)
InChI key:InChIKey=YGZJLINOUVVOMY-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1N(CC(F)(F)F)N=C(N)C1
Synonyms:- 1H-Pyrazole-5-carboxylic acid, 3-amino-1-(2,2,2-trifluoroethyl)-, methyl ester
- Methyl 3-amino-1-(2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.