CAS 1328640-74-9
:Ethyl 3-amino-1-(2,2-difluoroethyl)-1H-pyrazole-5-carboxylate
Description:
Ethyl 3-amino-1-(2,2-difluoroethyl)-1H-pyrazole-5-carboxylate is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features an ethyl ester functional group, contributing to its solubility in organic solvents. The presence of the amino group enhances its potential for hydrogen bonding, which can influence its reactivity and interaction with biological targets. The difluoroethyl substituent introduces significant electronegativity, potentially affecting the compound's lipophilicity and overall biological activity. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its molecular structure suggests potential applications in agrochemicals or pharmaceuticals, particularly in the development of new therapeutic agents. As with many pyrazole derivatives, the specific arrangement of substituents can lead to diverse biological activities, warranting further investigation into its synthesis, stability, and reactivity under various conditions.
Formula:C8H11F2N3O2
InChI:InChI=1S/C8H11F2N3O2/c1-2-15-8(14)5-3-7(11)12-13(5)4-6(9)10/h3,6H,2,4H2,1H3,(H2,11,12)
InChI key:InChIKey=CVDZCJXZHBFXHA-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1N(CC(F)F)N=C(N)C1
Synonyms:- 1H-Pyrazole-5-carboxylic acid, 3-amino-1-(2,2-difluoroethyl)-, ethyl ester
- Ethyl 3-amino-1-(2,2-difluoroethyl)-1H-pyrazole-5-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.