CAS 1328640-75-0

1-(1-Methylethyl)-1H-pyrazole-3-ethanamine

Description:

1-(1-Methylethyl)-1H-pyrazole-3-ethanamine, identified by its CAS number 1328640-75-0, is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features an isopropyl group (1-methylethyl) and an ethylamine side chain, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the amine functional group suggests that it may exhibit basic properties and can participate in hydrogen bonding, influencing its solubility in polar solvents. Additionally, the pyrazole moiety is known for its biological activity, making this compound of interest in medicinal chemistry and drug development. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular structure, which can affect its potential applications in pharmaceuticals or agrochemicals. Safety data and handling precautions should be consulted due to the potential for biological activity and reactivity.

Formula: C₈H₁₅N₃

InChI: InChI=1S/C8H15N3/c1-7(2)11-6-4-8(10-11)3-5-9/h4,6-7H,3,5,9H2,1-2H3

InChI key: InChIKey=TYBUHAZYOVLWBU-UHFFFAOYSA-N

SMILES: C(C)(C)N1N=C(CCN)C=C1

Synonyms:

• 1H-Pyrazole-3-ethanamine, 1-(1-methylethyl)-
• 1-(1-Methylethyl)-1H-pyrazole-3-ethanamine

2-[1-(Propan-2-yl)-1H-pyrazol-3-yl]ethan-1-amine

CAS: 1328640-75-0

Versatile small molecule scaffold

Formula: C₈H₁₅N₃

Purity: Min. 95%

Molecular weight: 153.22 g/mol

Ref: 3D-DDC64075