CAS 1328640-81-8

1-Ethyl-1H-pyrazole-3-ethanamine

Description:

1-Ethyl-1H-pyrazole-3-ethanamine is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features an ethyl group and an ethanamine substituent, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the amine functional group suggests that it may exhibit basic properties and can participate in hydrogen bonding, making it potentially soluble in polar solvents. Its structure may allow for various applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyrazole derivatives. Additionally, the compound's reactivity can be influenced by the electron-donating ethyl group, which may affect its interaction with other chemical species. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₇H₁₃N₃

InChI: InChI=1S/C7H13N3/c1-2-10-6-4-7(9-10)3-5-8/h4,6H,2-3,5,8H2,1H3

InChI key: InChIKey=XIYRERTYEBKFHT-UHFFFAOYSA-N

SMILES: C(CN)C1=NN(CC)C=C1

Synonyms:

• 1-Ethyl-1H-pyrazole-3-ethanamine
• 1H-Pyrazole-3-ethanamine, 1-ethyl-
• 2-(1-Ethyl-1H-pyrazol-3-yl)ethan-1-amine

2-(1-Ethyl-1H-pyrazol-3-yl)ethan-1-amine

CAS: 1328640-81-8

Versatile small molecule scaffold

Formula: C₇H₁₃N₃

Purity: Min. 95%

Molecular weight: 139.2 g/mol

Ref: 3D-DDC64081