
CAS 1328640-89-6
:5,7-Dimethylpyrazolo[1,5-a]pyrimidine-2-methanol
Description:
5,7-Dimethylpyrazolo[1,5-a]pyrimidine-2-methanol is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrazole and pyrimidine rings. This compound features two methyl groups at the 5 and 7 positions of the pyrazolo ring, contributing to its distinct chemical properties and potential biological activity. The presence of a hydroxymethyl group at the 2-position of the pyrimidine ring enhances its reactivity and solubility in polar solvents. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure allows for various interactions with biological targets, potentially influencing enzyme activity or receptor binding. Additionally, the compound's stability and reactivity can be influenced by the presence of the methyl and hydroxymethyl substituents, which may affect its synthesis and application in research. Overall, 5,7-Dimethylpyrazolo[1,5-a]pyrimidine-2-methanol represents a versatile scaffold for further exploration in drug development and chemical synthesis.
Formula:C9H11N3O
InChI:InChI=1S/C9H11N3O/c1-6-3-7(2)12-9(10-6)4-8(5-13)11-12/h3-4,13H,5H2,1-2H3
InChI key:InChIKey=KQBRHRNZAWODIL-UHFFFAOYSA-N
SMILES:CC=1N2C(=CC(CO)=N2)N=C(C)C1
Synonyms:- 5,7-Dimethylpyrazolo[1,5-a]pyrimidine-2-methanol
- Pyrazolo[1,5-a]pyrimidine-2-methanol, 5,7-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.