CAS 13287-24-6
:9-Methylnonadecane
Description:
9-Methylnonadecane is a long-chain alkane with the molecular formula C20H42, characterized by a straight-chain structure with a methyl group located at the ninth carbon position. This compound is part of the larger family of alkanes, which are saturated hydrocarbons consisting solely of carbon and hydrogen atoms. It is typically a colorless, odorless liquid at room temperature and exhibits low volatility and high stability due to its saturated nature. The presence of the methyl group introduces a degree of branching, which can influence its physical properties, such as melting and boiling points, compared to its straight-chain counterparts. 9-Methylnonadecane is insoluble in water but soluble in organic solvents, making it relevant in various industrial applications, including lubricants and fuel additives. Its relatively high molecular weight contributes to its hydrophobic characteristics, and it may also be studied for its potential environmental impact and behavior in biological systems. As with many long-chain hydrocarbons, it is important to handle it with care due to potential health and environmental risks.
Formula:C20H42
InChI:InChI=1S/C20H42/c1-4-6-8-10-12-13-15-17-19-20(3)18-16-14-11-9-7-5-2/h20H,4-19H2,1-3H3
InChI key:InChIKey=FFVPRSKCTDQLBP-UHFFFAOYSA-N
SMILES:C(C(CCCCCCCC)C)CCCCCCCCC
Synonyms:- 11-Methylnonadec-1-Ene
- A 20H
- Linealene Dimer A 20H
- NSC 158662
- Nonadecane, 9-methyl-
- 9-Methylnonadecane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
