CAS 132875-61-7
:Remifentanil
Description:
Remifentanil is a potent, ultra-short-acting synthetic opioid analgesic primarily used in medical settings for pain management and anesthesia. It is classified as a mu-opioid receptor agonist, which means it binds to specific receptors in the brain to produce analgesia and sedation. Remifentanil is characterized by its rapid onset and very short duration of action, typically lasting only a few minutes, which allows for precise control over analgesia during surgical procedures. Its pharmacokinetics are unique due to its metabolism by non-specific plasma esterases, leading to a quick clearance from the body, making it particularly useful in situations where quick recovery from anesthesia is desired. The substance is usually administered intravenously and is known for its potential to cause respiratory depression, necessitating careful monitoring during use. Additionally, remifentanil is often used in combination with other anesthetic agents to enhance overall analgesic effects while minimizing side effects.
Formula:C20H28N2O5
InChI:InChI=1S/C20H28N2O5/c1-4-17(23)22(16-8-6-5-7-9-16)20(19(25)27-3)11-14-21(15-12-20)13-10-18(24)26-2/h5-9H,4,10-15H2,1-3H3
InChI key:InChIKey=ZTVQQQVZCWLTDF-UHFFFAOYSA-N
SMILES:N(C(CC)=O)(C1(C(OC)=O)CCN(CCC(OC)=O)CC1)C2=CC=CC=C2
Synonyms:- Gi 87084X
- Ramifentanyl
- Remifentanil
- Remifentanyl
- Ultiva
- 1-Piperidinepropanoic acid, 4-(methoxycarbonyl)-4-[(1-oxopropyl)phenylamino]-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-(Butyryl-phenyl-amino)-1-(methoxycarbonyl-ethyl)-piperidine-4-carboxylic Acid Methyl Ester
CAS:Controlled ProductFormula:C21H30N2O5Color and Shape:NeatMolecular weight:390.48
