CAS 13288-06-7
:1-(2-Bromoethoxy)-4-nitrobenzene
Description:
1-(2-Bromoethoxy)-4-nitrobenzene, with the CAS number 13288-06-7, is an organic compound characterized by its aromatic structure and the presence of both a nitro group and a bromoethoxy substituent. This compound features a nitro group (-NO2) attached to a benzene ring, which is known for its electron-withdrawing properties, influencing the reactivity of the molecule. The bromoethoxy group, consisting of a bromoalkyl chain linked to an ether, contributes to the compound's overall polarity and solubility characteristics. Typically, compounds like this can exhibit moderate to high reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. Additionally, the nitro group can enhance the electrophilic character of the aromatic ring, making it susceptible to further chemical modifications. This compound may find applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its functional groups that allow for diverse chemical transformations. Safety and handling precautions are essential, as both brominated compounds and nitro compounds can pose health and environmental risks.
Formula:C8H8BrNO3
InChI:InChI=1/C8H8BrNO3/c9-5-6-13-8-3-1-7(2-4-8)10(11)12/h1-4H,5-6H2
SMILES:c1cc(ccc1N(=O)=O)OCCBr
Synonyms:- 2-Bromoethyl 4-nitrophenyl ether
- 2-Bromoethyl p-nitrophenyl ether
- Benzene, 1-(2-Bromoethoxy)-4-Nitro-
- 1-(2-Bromoethoxy)-4-Nitro-Benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzene, 1-(2-bromoethoxy)-4-nitro-
CAS:Formula:C8H8BrNO3Purity:95%Color and Shape:SolidMolecular weight:246.05801-(2-Bromoethoxy)-4-nitrobenzene
CAS:1-(2-Bromoethoxy)-4-nitrobenzeneFormula:C8H8BrNO3Purity:95%Color and Shape: beige solidMolecular weight:246.06g/mol2-Bromoethyl-4-nitrophenyl Ether
CAS:Controlled ProductApplications 2-Bromoethyl-4-nitrophenyl Ether (cas# 13288-06-7) is a compound useful in organic synthesis.
Formula:C8H8BrNO3Color and Shape:NeatMolecular weight:246.06β-Bromo-4-nitrophenetole
CAS:Formula:C8H8BrNO3Purity:>97.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:246.06




