CymitQuimica logo

CAS 13288-29-4

:

2,4-Dioxatricyclo[3.3.1.13,7]decane

Description:
2,4-Dioxatricyclo[3.3.1.1^3,7]decane, with the CAS number 13288-29-4, is a bicyclic organic compound characterized by its unique tricyclic structure that includes two oxygen atoms incorporated into the ring system. This compound features a fused bicyclic framework, which contributes to its stability and potential reactivity. The presence of the dioxane moiety suggests that it may exhibit properties typical of ethers, such as solubility in organic solvents and potential reactivity with nucleophiles. Its molecular structure may influence its physical properties, including boiling and melting points, which are generally higher than those of non-cyclic analogs due to increased molecular interactions. Additionally, the compound may have applications in organic synthesis or materials science, although specific uses may vary based on its reactivity and functionalization potential. Overall, 2,4-Dioxatricyclo[3.3.1.1^3,7]decane represents an interesting subject for further study in the fields of organic chemistry and materials development.
Formula:C8H12O2
InChI:InChI=1S/C8H12O2/c1-5-2-7-4-6(1)9-8(3-5)10-7/h5-8H,1-4H2
InChI key:InChIKey=FDGDVYKHAJJROE-UHFFFAOYSA-N
SMILES:C12CC3CC(C1)OC(C2)O3
Synonyms:
  • 2,4-Dioxatricyclo[3.3.1.13,7]decane
  • 2,4-Dioxaadamantane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.