CymitQuimica logo

CAS 132885-82-6

:

(3-bromophenyl)(4-tert-butylphenyl)methanone

Description:
(3-bromophenyl)(4-tert-butylphenyl)methanone, with the CAS number 132885-82-6, is an organic compound characterized by its ketone functional group, which is indicated by the presence of the methanone moiety. This compound features a bromine atom attached to a phenyl ring at the meta position, and a tert-butyl group on another phenyl ring at the para position. The presence of the bromine atom contributes to its reactivity and potential applications in organic synthesis, while the bulky tert-butyl group can influence the compound's steric properties and solubility. The overall structure suggests that it may exhibit interesting electronic properties due to the conjugation between the aromatic rings and the carbonyl group. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential as an intermediate in the synthesis of more complex molecules. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions between its functional groups and the surrounding environment.
Formula:C17H17BrO
InChI:InChI=1/C17H17BrO/c1-17(2,3)14-9-7-12(8-10-14)16(19)13-5-4-6-15(18)11-13/h4-11H,1-3H3
SMILES:CC(C)(C)c1ccc(cc1)C(=O)c1cccc(c1)Br
Synonyms:
  • Methanone, (3-bromophenyl)[4-(1,1-dimethylethyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.