CAS 132898-03-4

1H-Imidazo[4,5-b]pyridin-2-amine(9CI)

Description:

1H-Imidazo[4,5-b]pyridin-2-amine, also known by its CAS number 132898-03-4, is a heterocyclic organic compound characterized by a fused imidazole and pyridine ring system. This compound features an amino group at the 2-position of the imidazo ring, which contributes to its potential reactivity and biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. The structure of 1H-Imidazo[4,5-b]pyridin-2-amine allows for various interactions, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its unique ring system can facilitate interactions with biological macromolecules, potentially leading to applications in drug discovery. Additionally, the compound may exhibit fluorescence properties, which can be useful in biochemical assays. Overall, 1H-Imidazo[4,5-b]pyridin-2-amine is a compound of interest due to its structural features and potential applications in various fields of research.

Formula: C₆H₆N₄

InChI: InChI=1/C6H6N4/c7-6-9-4-2-1-3-8-5(4)10-6/h1-3H,(H3,7,8,9,10)

SMILES: c1cc2c(nc1)[nH]c(=N)[nH]2

Synonyms:

• 1H-imidazo[4,5-b]pyridin-2-amine

3H-Imidazo[4,5-b]pyridin-2-amine

CAS: 132898-03-4

Formula: C₆H₆N₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 134.1386

Ref: IN-DA0011CM

1H-Imidazo[4,5-b]pyridin-2-amine

CAS: 132898-03-4

Purity: ≥95%

Molecular weight: 134.1419983

Ref: 10-F613811