CAS 132898-05-6

5,7-Dimethyl-3H-imidazo[4,5-b]pyridin-2-amine

Description:

5,7-Dimethyl-3H-imidazo[4,5-b]pyridin-2-amine is a heterocyclic organic compound characterized by its imidazo[4,5-b]pyridine structure, which features a fused ring system containing nitrogen atoms. This compound typically exhibits properties such as being a solid at room temperature and having moderate solubility in polar solvents due to the presence of amino and methyl groups. The presence of these functional groups can influence its reactivity and potential biological activity, making it of interest in medicinal chemistry. It may act as a ligand or a precursor in the synthesis of more complex molecules. The compound's molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Additionally, its unique arrangement of methyl groups can affect its electronic properties, potentially influencing its interaction with biological targets. As with many heterocycles, it may also exhibit interesting photophysical properties, making it a candidate for further research in various chemical and biological contexts.

Formula: C₈H₁₀N₄

InChI: InChI=1S/C8H10N4/c1-4-3-5(2)10-7-6(4)11-8(9)12-7/h3H,1-2H3,(H3,9,10,11,12)

InChI key: InChIKey=ARWZSXPEMUKYIQ-UHFFFAOYSA-N

SMILES: CC1=C2C(N=C(N)N2)=NC(C)=C1

Synonyms:

• 5,7-Dimethyl-3H-imidazo[4,5-b]pyridin-2-amine
• 3H-Imidazo[4,5-b]pyridin-2-amine, 5,7-dimethyl-
• 1H-Imidazo[4,5-b]pyridin-2-amine, 5,7-dimethyl-