CAS 1329-10-8

5-(β-D-Glucopyranosyloxy)-7-hydroxy-2-phenyl-4H-1-benzopyran-4-one

Description:

5-(β-D-Glucopyranosyloxy)-7-hydroxy-2-phenyl-4H-1-benzopyran-4-one, also known as a flavonoid compound, exhibits several notable characteristics. This substance features a flavone backbone, which is characterized by a chromone structure with a phenolic hydroxyl group and a glycosyl moiety, specifically a β-D-glucopyranosyl group. The presence of the glucopyranosyl group enhances its solubility in water and may influence its biological activity, including antioxidant properties. The hydroxyl groups contribute to its potential as a radical scavenger, while the phenyl group may enhance its interaction with biological targets. This compound is of interest in pharmacology and natural product chemistry due to its potential health benefits, including anti-inflammatory and anticancer activities. Its structural complexity allows for various interactions within biological systems, making it a subject of research in the fields of medicinal chemistry and phytochemistry. Overall, this compound exemplifies the diverse functionalities of flavonoids in nature and their potential applications in health and medicine.

Formula: C₂₁H₂₀O₉

InChI: InChI=1S/C21H20O9/c22-9-16-18(25)19(26)20(27)21(30-16)29-15-7-11(23)6-14-17(15)12(24)8-13(28-14)10-4-2-1-3-5-10/h1-8,16,18-23,25-27H,9H2/t16-,18-,19+,20-,21-/m1/s1

InChI key: InChIKey=IRHAYEHCEVRWSB-QNDFHXLGSA-N

SMILES: O(C1=C2C(OC(=CC2=O)C3=CC=CC=C3)=CC(O)=C1)[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O

Synonyms:

• Toringin
• 5-(β-D-Glucopyranosyloxy)-7-hydroxy-2-phenyl-4H-1-benzopyran-4-one
• 4H-1-Benzopyran-4-one, 5-(β-D-glucopyranosyloxy)-7-hydroxy-2-phenyl-

Toringin

CAS: 1329-10-8

Toringin

Purity: ≥98%

Molecular weight: 416.38g/mol

Ref: 54-BUP21607

Toringin

CAS: 1329-10-8

Formula: C₂₁H₂₀O₉

Molecular weight: 416.38

Ref: 7W-GY0181

Toringin

CAS: 1329-10-8

Formula: C₂₁H₂₀O₉

Purity: 95%~99%

Molecular weight: 416.382

Ref: BP-BP3965

Toringin

CAS: 1329-10-8

Toringin is a bioflavonoid isolated from the bark of Docyniopsis tschonoski, which inhibits CTG-250 cytotoxicity.

Formula: C₂₁H₂₀O₉

Purity: 99.57%

Color and Shape: Solid

Molecular weight: 416.38

Ref: TM-T13933

Toringin

CAS: 1329-10-8

Toringin is an alkaloid derivative, which is extracted from naturally occurring plant sources. Its mode of action involves the modulation of biochemical pathways, specifically through interaction with neuronal receptors, potentially influencing neurotransmitter release and synaptic plasticity. Toringin's molecular structure allows it to cross the blood-brain barrier, enabling its effects on central nervous system activity.

Formula: C₂₁H₂₀O₉

Purity: Min. 95%

Molecular weight: 416.4 g/mol

Ref: 3D-BAA32910