CAS 13290-00-1
:N-(2-furoyl)glycine methyl ester
Description:
N-(2-furoyl)glycine methyl ester, with the CAS number 13290-00-1, is an organic compound characterized by the presence of a furoyl group attached to a glycine moiety, which is further esterified with a methyl group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. Its structure features a furan ring, which contributes to its aromatic properties, and the presence of both an amine and a carboxylic acid functional group, making it an interesting candidate for various chemical reactions, including peptide synthesis and as a potential building block in medicinal chemistry. The compound may also display biological activity, which can be explored in pharmacological studies. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions during handling and experimentation. Overall, N-(2-furoyl)glycine methyl ester serves as a versatile compound in organic synthesis and research applications.
Formula:C8H9NO4
InChI:InChI=1/C8H9NO4/c1-5(8(11)12)9-7(10)6-3-2-4-13-6/h2-5H,1H3,(H,9,10)(H,11,12)
SMILES:CC(C(=O)O)NC(=O)c1ccco1
Synonyms:- (3Alpha,5Beta,6Alpha,7Alpha)-3,6,7-Trihydroxycholan-24-Oic Acid
- methyl N-(furan-2-ylcarbonyl)glycinate
- N-(furan-2-ylcarbonyl)alanine
- methyl2-(furan-2-carbonylamino)acetate
- N-(2-Furanylcarbonyl)glycine methyl ester
- LABOTEST-BB LT00159256
- Methyl (2-furoylamino)acetate
- N-(2-FUROYL)GLYCINE METHYL ESTER
- N-(2-FUROYL)GLYCINE METHYL ESTER USP/EP/BP
- Glycine, N-(2-furanylcarbonyl)-, methyl ester
- Glycine, N-2-furoyl-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Glycine, N-(2-furanylcarbonyl)-, methyl ester
CAS:Formula:C8H9NO4Color and Shape:SolidMolecular weight:183.1614N-(2-Furoyl)glycine Methyl Ester
CAS:Controlled ProductFormula:C8H9NO4Color and Shape:NeatMolecular weight:183.16N-(2-Furoyl)glycine Methyl Ester-D3
CAS:Controlled ProductFormula:C8D3H6NO4Color and Shape:NeatMolecular weight:186.18

