CAS 1329115-53-8

4′-Fluoro-2′-methoxy[1,1′-biphenyl]-3-carboxaldehyde

Description:

4′-Fluoro-2′-methoxy[1,1′-biphenyl]-3-carboxaldehyde is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the para position and a methoxy group at the ortho position relative to the carboxaldehyde functional group significantly influences its chemical properties and reactivity. This compound features a carboxaldehyde functional group, which is known for its reactivity in various organic reactions, including nucleophilic addition and oxidation. The methoxy group can enhance the compound's solubility in organic solvents and may also affect its electronic properties, making it a potential candidate for applications in organic synthesis and medicinal chemistry. Additionally, the fluorine atom can impart unique characteristics such as increased lipophilicity and altered biological activity. Overall, this compound's structural features suggest potential utility in the development of pharmaceuticals or agrochemicals, although specific applications would depend on further research and evaluation.

Formula: C₁₄H₁₁FO₂

InChI: InChI=1S/C14H11FO2/c1-17-14-8-12(15)5-6-13(14)11-4-2-3-10(7-11)9-16/h2-9H,1H3

InChI key: InChIKey=HRAWMDVXVSYFDM-UHFFFAOYSA-N

SMILES: O(C)C1=C(C2=CC(C=O)=CC=C2)C=CC(F)=C1

Synonyms:

• 4′-Fluoro-2′-methoxy[1,1′-biphenyl]-3-carboxaldehyde
• [1,1′-Biphenyl]-3-carboxaldehyde, 4′-fluoro-2′-methoxy-