CymitQuimica logo

CAS 1329167-03-4

:

4,6-Difluoro-1,3-dimethyl-1H-indazole

Description:
4,6-Difluoro-1,3-dimethyl-1H-indazole is a synthetic organic compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of two fluorine atoms at the 4 and 6 positions of the indazole ring significantly influences its chemical properties, including increased lipophilicity and potential biological activity. The dimethyl groups at the 1 and 3 positions contribute to the compound's steric bulk and may affect its interaction with biological targets. This compound is typically studied in the context of medicinal chemistry and drug development, as fluorinated compounds often exhibit enhanced metabolic stability and altered pharmacokinetics. Its unique structure may also impart specific reactivity patterns, making it of interest in various synthetic applications. As with many fluorinated compounds, safety and handling considerations are important due to potential toxicity and environmental impact. Overall, 4,6-Difluoro-1,3-dimethyl-1H-indazole represents a valuable compound for research in both chemical synthesis and pharmacology.
Formula:C9H8F2N2
InChI:InChI=1S/C9H8F2N2/c1-5-9-7(11)3-6(10)4-8(9)13(2)12-5/h3-4H,1-2H3
InChI key:InChIKey=DTFZBKPJMZIJQI-UHFFFAOYSA-N
SMILES:CN1C=2C(C(C)=N1)=C(F)C=C(F)C2
Synonyms:
  • 4,6-Difluoro-1,3-dimethyl-1H-indazole
  • 1H-Indazole, 4,6-difluoro-1,3-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.