CAS 132922-80-6
:rubrofusarin-6-glucoside
Description:
Rubrofusarin-6-glucoside is a naturally occurring compound classified as a flavonoid glycoside. It is derived from various plant sources and is known for its potential biological activities, including antioxidant and anti-inflammatory properties. The structure of rubrofusarin-6-glucoside consists of a flavonoid backbone with a glucose moiety attached, which influences its solubility and bioavailability. This compound has garnered interest in pharmacological research due to its potential therapeutic effects, particularly in the context of chronic diseases. Additionally, rubrofusarin-6-glucoside may exhibit various interactions with cellular pathways, contributing to its health benefits. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial applications. As research continues, further elucidation of its mechanisms of action and potential applications in medicine and nutrition is anticipated.
Formula:C21H22O10
InChI:InChI=1/C21H22O10/c1-8-3-11(23)16-12(29-8)5-9-4-10(28-2)6-13(15(9)18(16)25)30-21-20(27)19(26)17(24)14(7-22)31-21/h3-6,14,17,19-22,24-27H,7H2,1-2H3/t14-,17-,19+,20-,21-/m1/s1
Synonyms:- 4H-Naphtho(2,3-b)pyran-4-one, 6-(beta-D-glucopyranosyloxy)-5-hydroxy-8-methoxy-2-methyl-
- 6-(beta-D-Glucopyranosyloxy)-5-hydroxy-8-methoxy-2-methyl-4H-naphtho(2,3-b)pyran-4-one
- Rubrofusarin-6-glucoside
- 5-hydroxy-8-methoxy-2-methyl-4-oxo-4H-benzo[g]chromen-6-yl beta-D-glucopyranoside
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Rubrofusarin 6-O-β-D-glucopyranoside
CAS:<p>Rubrofusarin 6-O-β-D-glucopyranoside, a glycosidic derivative of Rubrofusarin, functions as an inhibitor of protein tyrosine phosphatase 1B (PTP1B) with an IC50</p>Formula:C21H22O10Color and Shape:SolidMolecular weight:434.39
