CymitQuimica logo

CAS 13293-13-5

:

5-NITRO-2-FURALDEHYDE (4-HYDROXY-6-METHYLPYRIMIDIN-2-YL)-HYDRAZONE

Description:
5-Nitro-2-furaldehyde (4-hydroxy-6-methylpyrimidin-2-yl)-hydrazone, identified by CAS number 13293-13-5, is a chemical compound characterized by its complex structure, which includes a furaldehyde moiety and a hydrazone linkage. This compound typically exhibits a yellow to orange color and is soluble in organic solvents, reflecting its polar functional groups. The presence of the nitro group contributes to its reactivity, making it a potential candidate for various chemical reactions, including those involving nucleophiles. The hydrazone functional group is known for its ability to form stable complexes with metal ions, which can be exploited in coordination chemistry. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its synthesis often involves the condensation of the respective hydrazine derivative with the furaldehyde, highlighting its relevance in organic synthesis. Overall, 5-nitro-2-furaldehyde (4-hydroxy-6-methylpyrimidin-2-yl)-hydrazone is a versatile compound with potential applications in both chemical and biological fields.
Formula:C10H9N5O4
InChI:InChI=1/C10H9N5O4/c1-6-4-8(16)13-10(12-6)14-11-5-7-2-3-9(19-7)15(17)18/h2-5H,1H3,(H2,12,13,14,16)
SMILES:Cc1cc(nc(n1)NN=Cc1ccc(N(=O)=O)o1)O
Synonyms:
  • 2-Furancarboxaldehyde, 5-Nitro-, 2-(4-Hydroxy-6-Methyl-2-Pyrimidinyl)Hydrazone
  • 6-methyl-2-{2-[(5-nitro-2-furyl)methylene]hydrazino}pyrimidin-4(1H)-one
  • 6-methyl-2-{2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl}pyrimidin-4(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.