CymitQuimica logo

CAS 132937-88-3

:

6-hydroxy-2-{2-[(2-hydroxyethyl)amino]ethyl}-5-{[2-(methylamino)ethyl]amino}-1,2-dihydrodibenzo[cd,g]indazole-7,10-dione dihydrochloride hydrate

Description:
6-Hydroxy-2-{2-[(2-hydroxyethyl)amino]ethyl}-5-{[2-(methylamino)ethyl]amino}-1,2-dihydrodibenzo[cd,g]indazole-7,10-dione dihydrochloride hydrate, with CAS number 132937-88-3, is a complex organic compound characterized by its multi-functional structure, which includes hydroxyl, amino, and methylamino groups. This compound is a derivative of dibenzoindazole, featuring a dihydrodibenzo structure that contributes to its potential biological activity. The presence of multiple amino groups suggests that it may engage in hydrogen bonding and interact with various biological targets, making it of interest in medicinal chemistry. The dihydrochloride form indicates that it is a salt, which can enhance its solubility in aqueous environments, a crucial factor for pharmacological applications. Additionally, the hydrate form implies that it contains water molecules in its crystalline structure, which can influence its stability and solubility. Overall, this compound's intricate structure and functional groups position it as a candidate for further research in drug development and therapeutic applications.
Formula:C21H29Cl2N5O5
InChI:InChI=1/C21H25N5O4.2ClH.H2O/c1-22-6-7-24-12-2-3-13-17-16(12)21(30)19-15(29)5-4-14(28)18(19)20(17)25-26(13)10-8-23-9-11-27;;;/h2-5,22-25,27,30H,6-11H2,1H3;2*1H;1H2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.