CAS 13294-23-0

Bis[(trimethylsilyl)methyl]mercury

Description:

Bis[(trimethylsilyl)methyl]mercury, with the CAS number 13294-23-0, is an organomercury compound characterized by its unique structure, which includes two trimethylsilyl groups attached to a central mercury atom. This compound is typically a colorless to pale yellow liquid and is known for its volatility and low boiling point. It exhibits significant reactivity due to the presence of the mercury atom, which can form various coordination complexes. The trimethylsilyl groups enhance its stability and solubility in organic solvents, making it useful in various chemical applications, including as a reagent in organic synthesis. However, like many organomercury compounds, it poses health and environmental risks due to mercury's toxicity, necessitating careful handling and disposal. Its applications may extend to fields such as materials science and catalysis, but safety precautions are paramount due to the potential for bioaccumulation and adverse effects on living organisms.

Formula: C₈H₂₂HgSi₂

InChI: InChI=1S/2C4H11Si.Hg/c2*1-5(2,3)4;/h2*1H2,2-4H3;

InChI key: InChIKey=UQOFJLBRRNSQKQ-UHFFFAOYSA-N

SMILES: C([Si](C)(C)C)[Hg]C[Si](C)(C)C

Synonyms:

• 2,6-Disila-4-mercuraheptane, 2,2,6,6-tetramethyl-
• Bis(trimethylsilylmethyl)mercury
• Silane, tetramethyl-, mercury complex
• Mercury, bis[(trimethylsilyl)methyl]-
• Bis[(trimethylsilyl)methyl]mercury

Mercury, bis[(trimethylsilyl)methyl]-

CAS: 13294-23-0

Formula: C₈H₂₂HgSi₂

Molecular weight: 375.0213

Ref: IN-DA0011ES