CAS 132942-81-5
:4-CHLORO-5-FLUORO-O-PHENYLENEDIAMINE
Description:
4-Chloro-5-fluoro-o-phenylenediamine, with the CAS number 132942-81-5, is an organic compound characterized by the presence of both chlorine and fluorine substituents on a phenylene diamine structure. This compound typically appears as a solid and is known for its potential applications in dye synthesis and as an intermediate in organic synthesis. The presence of the chloro and fluoro groups can influence its reactivity, solubility, and stability, making it a subject of interest in various chemical processes. It may exhibit properties such as moderate to high melting points and varying solubility in organic solvents, depending on the specific conditions. Additionally, due to the presence of amine groups, it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed in laboratory settings. Overall, 4-chloro-5-fluoro-o-phenylenediamine is a valuable compound in the field of synthetic organic chemistry.
Formula:C6H6ClFN2
InChI:InChI=1/C6H6ClFN2/c7-3-1-5(9)6(10)2-4(3)8/h1-2H,9-10H2
Synonyms:- 4-chloro-5-fluorobenzene-1,2-diamine
- 4-Chloro-1,2-diamino-5-fluorobenzene
- 4-CHLORO-1,2-DIAMINO-5-FLUOROBENZENE
- TIMTEC-BB SBB003959
- 1-CHLORO-4,5-DIAMINO-2-FLUOROBENZENE
- BUTTPARK 44\03-90
- 1,2-Diamino-4-chloro-5-fluorobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
